About 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine
3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine (PubChem CID 82047166) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine.
Molecular Properties
| Compound Name | 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine |
| PubChem CID | 82047166 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine |
| SMILES | Cc1cc2c(cc1C)OC1(C=C2)CCN(CCCN)C1 |
| InChI | InChI=1S/C17H24N2O/c1-13-10-15-4-5-17(20-16(15)11-14(13)2)6-9-19(12-17)8-3-7-18/h4-5,10-11H,3,6-9,12,18H2,1-2H3 |
| InChIKey | XUUCOURUONXCQT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine?
The IUPAC name of 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine (CID 82047166) is 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine.
What is the SMILES notation for 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine?
The canonical SMILES for 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine is Cc1cc2c(cc1C)OC1(C=C2)CCN(CCCN)C1.
What is the InChIKey of 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine?
The InChIKey is XUUCOURUONXCQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-13-10-15-4-5-17(20-16(15)11-14(13)2)6-9-19(12-17)8-3-7-18/h4-5,10-11H,3,6-9,12,18H2,1-2H3.
What are the key properties of 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine?
3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine has a molecular weight of 272.39 g/mol, XLogP of 2.50, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(6,7-dimethylspiro[chromene-2,3'-pyrrolidine]-1'-yl)propan-1-amine is sourced from PubChem (CID 82047166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).