About 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile
6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile (PubChem CID 82047728) has the molecular formula C11H5NO4
and a molecular weight of 215.16 g/mol. Its IUPAC name is 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile.
Molecular Properties
| Compound Name | 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile |
| PubChem CID | 82047728 |
| Molecular Formula | C11H5NO4 |
| Molecular Weight | 215.16 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile |
| SMILES | N#Cc1coc2c3c(ccc2c1=O)OCO3 |
| InChI | InChI=1S/C11H5NO4/c12-3-6-4-14-10-7(9(6)13)1-2-8-11(10)16-5-15-8/h1-2,4H,5H2 |
| InChIKey | OGUDPNUEQWXMSJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 72.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile?
The IUPAC name of 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile (CID 82047728) is 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile.
What is the SMILES notation for 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile?
The canonical SMILES for 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile is N#Cc1coc2c3c(ccc2c1=O)OCO3.
What is the InChIKey of 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile?
The InChIKey is OGUDPNUEQWXMSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5NO4/c12-3-6-4-14-10-7(9(6)13)1-2-8-11(10)16-5-15-8/h1-2,4H,5H2.
What are the key properties of 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile?
6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile has a molecular weight of 215.16 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-[1,3]dioxolo[4,5-h]chromene-7-carbonitrile is sourced from PubChem (CID 82047728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).