C11H11FN4S — CID 82048179
3-[(4-fluorophenyl)methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 82048179) has the molecular formula C11H11FN4S and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-[(4-fluorophenyl)methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 82048179 |
| Molecular Formula | C11H11FN4S |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.07 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | Fc1ccc(Cc2nnc3n2NCCS3)cc1 |
| InChI | InChI=1S/C11H11FN4S/c12-9-3-1-8(2-4-9)7-10-14-15-11-16(10)13-5-6-17-11/h1-4,13H,5-7H2 |
| InChIKey | DYDGBYFBDTZSNX-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |