C13H16N4O3S — CID 82048204
3-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine (PubChem CID 82048204) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
|---|---|
| PubChem CID | 82048204 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)-6,7-dihydro-5H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazine |
| SMILES | COc1cc(-c2nnc3n2NCCS3)cc(OC)c1OC |
| InChI | InChI=1S/C13H16N4O3S/c1-18-9-6-8(7-10(19-2)11(9)20-3)12-15-16-13-17(12)14-4-5-21-13/h6-7,14H,4-5H2,1-3H3 |
| InChIKey | ZACGJMDQNDKBCB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 70.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |