C11H13N3 — CID 82048495
4-(2,5-dimethyl-1H-imidazol-4-yl)aniline (PubChem CID 82048495) has the molecular formula C11H13N3 and a molecular weight of 187.25 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1H-imidazol-4-yl)aniline.
| Compound Name | 4-(2,5-dimethyl-1H-imidazol-4-yl)aniline |
|---|---|
| PubChem CID | 82048495 |
| Molecular Formula | C11H13N3 |
| Molecular Weight | 187.25 g/mol |
| Exact Mass | 187.11 |
| IUPAC Name | 4-(2,5-dimethyl-1H-imidazol-4-yl)aniline |
| SMILES | Cc1nc(-c2ccc(N)cc2)c(C)[nH]1 |
| InChI | InChI=1S/C11H13N3/c1-7-11(14-8(2)13-7)9-3-5-10(12)6-4-9/h3-6H,12H2,1-2H3,(H,13,14) |
| InChIKey | VNJMUYQPVNZIGN-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|