3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid

C13H14N2O3 — CID 82049334

IUPAC3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)[nH]n2)cc1C
InChIInChI=1S/C13H14N2O3/c1-7-5-12(18-3)8(2)4-9(7)10-6-11(13(16)17)15-14-10/h4-6H,1-3H3,(H,14,15)(H,16,17)
InChIKeyCDERENNACNAYGR-UHFFFAOYSA-N
MW246.27 g/mol
LogP2.40
Rot. Bonds3

About 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid

3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (PubChem CID 82049334) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
PubChem CID82049334
Molecular FormulaC13H14N2O3
Molecular Weight246.27 g/mol
Exact Mass246.10
IUPAC Name3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid
SMILESCOc1cc(C)c(-c2cc(C(=O)O)[nH]n2)cc1C
InChIInChI=1S/C13H14N2O3/c1-7-5-12(18-3)8(2)4-9(7)10-6-11(13(16)17)15-14-10/h4-6H,1-3H3,(H,14,15)(H,16,17)
InChIKeyCDERENNACNAYGR-UHFFFAOYSA-N
XLogP2.40
TPSA75.21 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500246.27
LogP ≤ 52.40
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The IUPAC name of 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid (CID 82049334) is 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid.
What is the SMILES notation for 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The canonical SMILES for 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid is COc1cc(C)c(-c2cc(C(=O)O)[nH]n2)cc1C.
What is the InChIKey of 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
The InChIKey is CDERENNACNAYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O3/c1-7-5-12(18-3)8(2)4-9(7)10-6-11(13(16)17)15-14-10/h4-6H,1-3H3,(H,14,15)(H,16,17).
What are the key properties of 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid?
3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid has a molecular weight of 246.27 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-methoxy-2,5-dimethylphenyl)-1H-pyrazole-5-carboxylic acid is sourced from PubChem (CID 82049334), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).