C19H31NO3 — CID 82050380
3-(diethylamino)-1-[3,4-di(propan-2-yloxy)phenyl]propan-1-one (PubChem CID 82050380) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 3-(diethylamino)-1-[3,4-di(propan-2-yloxy)phenyl]propan-1-one.
| Compound Name | 3-(diethylamino)-1-[3,4-di(propan-2-yloxy)phenyl]propan-1-one |
|---|---|
| PubChem CID | 82050380 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 3-(diethylamino)-1-[3,4-di(propan-2-yloxy)phenyl]propan-1-one |
| SMILES | CCN(CC)CCC(=O)c1ccc(OC(C)C)c(OC(C)C)c1 |
| InChI | InChI=1S/C19H31NO3/c1-7-20(8-2)12-11-17(21)16-9-10-18(22-14(3)4)19(13-16)23-15(5)6/h9-10,13-15H,7-8,11-12H2,1-6H3 |
| InChIKey | YZHNVHBBSDEVAV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |