C15H14FN3O — CID 82055555
3-(2-aminoethyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-ol (PubChem CID 82055555) has the molecular formula C15H14FN3O and a molecular weight of 271.30 g/mol. Its IUPAC name is 3-(2-aminoethyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-ol.
| Compound Name | 3-(2-aminoethyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-ol |
|---|---|
| PubChem CID | 82055555 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 3-(2-aminoethyl)-2-(4-fluorophenyl)imidazo[1,2-a]pyridin-8-ol |
| SMILES | NCCc1c(-c2ccc(F)cc2)nc2c(O)cccn12 |
| InChI | InChI=1S/C15H14FN3O/c16-11-5-3-10(4-6-11)14-12(7-8-17)19-9-1-2-13(20)15(19)18-14/h1-6,9,20H,7-8,17H2 |
| InChIKey | PLFVKPDWJAZTKZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 63.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |