C9H11N3OS — CID 82055580
2-amino-5-ethyl-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82055580) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-amino-5-ethyl-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-amino-5-ethyl-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82055580 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 2-amino-5-ethyl-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1c(C)sc2nc(N)[nH]c(=O)c12 |
| InChI | InChI=1S/C9H11N3OS/c1-3-5-4(2)14-8-6(5)7(13)11-9(10)12-8/h3H2,1-2H3,(H3,10,11,12,13) |
| InChIKey | RXYSKJCWBCJXFY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |