2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid

C17H16N2O3 — CID 82055648

IUPAC2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid
SMILESO=C(O)Cc1cn2cccc(OCCc3ccccc3)c2n1
InChIInChI=1S/C17H16N2O3/c20-16(21)11-14-12-19-9-4-7-15(17(19)18-14)22-10-8-13-5-2-1-3-6-13/h1-7,9,12H,8,10-11H2,(H,20,21)
InChIKeyZAFGTNIWFVFHIV-UHFFFAOYSA-N
MW296.33 g/mol
LogP2.58
Rot. Bonds6

About 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid

2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid (PubChem CID 82055648) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid
PubChem CID82055648
Molecular FormulaC17H16N2O3
Molecular Weight296.33 g/mol
Exact Mass296.12
IUPAC Name2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid
SMILESO=C(O)Cc1cn2cccc(OCCc3ccccc3)c2n1
InChIInChI=1S/C17H16N2O3/c20-16(21)11-14-12-19-9-4-7-15(17(19)18-14)22-10-8-13-5-2-1-3-6-13/h1-7,9,12H,8,10-11H2,(H,20,21)
InChIKeyZAFGTNIWFVFHIV-UHFFFAOYSA-N
XLogP2.58
TPSA63.83 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500296.33
LogP ≤ 52.58
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The IUPAC name of 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid (CID 82055648) is 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid.
What is the SMILES notation for 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The canonical SMILES for 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid is O=C(O)Cc1cn2cccc(OCCc3ccccc3)c2n1.
What is the InChIKey of 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid?
The InChIKey is ZAFGTNIWFVFHIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O3/c20-16(21)11-14-12-19-9-4-7-15(17(19)18-14)22-10-8-13-5-2-1-3-6-13/h1-7,9,12H,8,10-11H2,(H,20,21).
What are the key properties of 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid?
2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid has a molecular weight of 296.33 g/mol, XLogP of 2.58, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[8-(2-phenylethoxy)imidazo[1,2-a]pyridin-2-yl]acetic acid is sourced from PubChem (CID 82055648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).