C16H24N4O2 — CID 82055769
2-[3-(2-aminoethyl)-2-methylimidazo[1,2-a]pyridin-8-yl]oxy-N-butylacetamide (PubChem CID 82055769) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[3-(2-aminoethyl)-2-methylimidazo[1,2-a]pyridin-8-yl]oxy-N-butylacetamide.
| Compound Name | 2-[3-(2-aminoethyl)-2-methylimidazo[1,2-a]pyridin-8-yl]oxy-N-butylacetamide |
|---|---|
| PubChem CID | 82055769 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[3-(2-aminoethyl)-2-methylimidazo[1,2-a]pyridin-8-yl]oxy-N-butylacetamide |
| SMILES | CCCCNC(=O)COc1cccn2c(CCN)c(C)nc12 |
| InChI | InChI=1S/C16H24N4O2/c1-3-4-9-18-15(21)11-22-14-6-5-10-20-13(7-8-17)12(2)19-16(14)20/h5-6,10H,3-4,7-9,11,17H2,1-2H3,(H,18,21) |
| InChIKey | IHFSNWYQXCSCPZ-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|