C16H16FNO4 — CID 82056183
4-[3-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid (PubChem CID 82056183) has the molecular formula C16H16FNO4 and a molecular weight of 305.31 g/mol. Its IUPAC name is 4-[3-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid.
| Compound Name | 4-[3-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid |
|---|---|
| PubChem CID | 82056183 |
| Molecular Formula | C16H16FNO4 |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 4-[3-[(4-fluorophenyl)methoxy]-2-oxo-1-pyridinyl]butanoic acid |
| SMILES | O=C(O)CCCn1cccc(OCc2ccc(F)cc2)c1=O |
| InChI | InChI=1S/C16H16FNO4/c17-13-7-5-12(6-8-13)11-22-14-3-1-9-18(16(14)21)10-2-4-15(19)20/h1,3,5-9H,2,4,10-11H2,(H,19,20) |
| InChIKey | RPWNMYBQGBISLS-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |