C10H16N2OS — CID 82056796
2-amino-N,N-diethyl-4-methylthiophene-3-carboxamide (PubChem CID 82056796) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 2-amino-N,N-diethyl-4-methylthiophene-3-carboxamide.
| Compound Name | 2-amino-N,N-diethyl-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 82056796 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 2-amino-N,N-diethyl-4-methylthiophene-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1c(C)csc1N |
| InChI | InChI=1S/C10H16N2OS/c1-4-12(5-2)10(13)8-7(3)6-14-9(8)11/h6H,4-5,11H2,1-3H3 |
| InChIKey | QPFOMQNAXRXXOH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |