About 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol
2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol (PubChem CID 82058201) has the molecular formula C10H19N5OS
and a molecular weight of 257.36 g/mol. Its IUPAC name is 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol |
| PubChem CID | 82058201 |
| Molecular Formula | C10H19N5OS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol |
| SMILES | Nc1nnc(CCN2CCN(CCO)CC2)s1 |
| InChI | InChI=1S/C10H19N5OS/c11-10-13-12-9(17-10)1-2-14-3-5-15(6-4-14)7-8-16/h16H,1-8H2,(H2,11,13) |
| InChIKey | GXAYRCWPNCZIHS-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol?
The IUPAC name of 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol (CID 82058201) is 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol?
The canonical SMILES for 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol is Nc1nnc(CCN2CCN(CCO)CC2)s1.
What is the InChIKey of 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol?
The InChIKey is GXAYRCWPNCZIHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N5OS/c11-10-13-12-9(17-10)1-2-14-3-5-15(6-4-14)7-8-16/h16H,1-8H2,(H2,11,13).
What are the key properties of 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol?
2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol has a molecular weight of 257.36 g/mol, XLogP of -0.73, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[2-(5-amino-1,3,4-thiadiazol-2-yl)ethyl]piperazin-1-yl]ethanol is sourced from PubChem (CID 82058201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).