C11H14N4O — CID 82058547
7-amino-2-(2-methylprop-2-enyl)-4H-pyrido[2,1-c][1,2,4]triazin-3-one (PubChem CID 82058547) has the molecular formula C11H14N4O and a molecular weight of 218.26 g/mol. Its IUPAC name is 7-amino-2-(2-methylprop-2-enyl)-4H-pyrido[2,1-c][1,2,4]triazin-3-one.
| Compound Name | 7-amino-2-(2-methylprop-2-enyl)-4H-pyrido[2,1-c][1,2,4]triazin-3-one |
|---|---|
| PubChem CID | 82058547 |
| Molecular Formula | C11H14N4O |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 7-amino-2-(2-methylprop-2-enyl)-4H-pyrido[2,1-c][1,2,4]triazin-3-one |
| SMILES | C=C(C)CN1N=C2C=CC(N)=CN2CC1=O |
| InChI | InChI=1S/C11H14N4O/c1-8(2)5-15-11(16)7-14-6-9(12)3-4-10(14)13-15/h3-4,6H,1,5,7,12H2,2H3 |
| InChIKey | CTPNTWZCINFGMF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|