C13H14N2OS — CID 82059374
2-ethyl-6-(1,3-thiazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 82059374) has the molecular formula C13H14N2OS and a molecular weight of 246.34 g/mol. Its IUPAC name is 2-ethyl-6-(1,3-thiazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2-ethyl-6-(1,3-thiazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82059374 |
| Molecular Formula | C13H14N2OS |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 2-ethyl-6-(1,3-thiazol-2-yl)-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CCC1CNc2cc(-c3nccs3)ccc2O1 |
| InChI | InChI=1S/C13H14N2OS/c1-2-10-8-15-11-7-9(3-4-12(11)16-10)13-14-5-6-17-13/h3-7,10,15H,2,8H2,1H3 |
| InChIKey | HJKSIMZNKJYXIG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |