C17H19N3O — CID 82059747
2-(2-ethoxyphenyl)-N-ethylimidazo[1,2-a]pyridin-6-amine (PubChem CID 82059747) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(2-ethoxyphenyl)-N-ethylimidazo[1,2-a]pyridin-6-amine.
| Compound Name | 2-(2-ethoxyphenyl)-N-ethylimidazo[1,2-a]pyridin-6-amine |
|---|---|
| PubChem CID | 82059747 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-(2-ethoxyphenyl)-N-ethylimidazo[1,2-a]pyridin-6-amine |
| SMILES | CCNc1ccc2nc(-c3ccccc3OCC)cn2c1 |
| InChI | InChI=1S/C17H19N3O/c1-3-18-13-9-10-17-19-15(12-20(17)11-13)14-7-5-6-8-16(14)21-4-2/h5-12,18H,3-4H2,1-2H3 |
| InChIKey | OIZKNAKUVGGZGZ-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |