C13H12N4 — CID 82059890
(2-pyridin-2-ylimidazo[1,2-a]pyridin-6-yl)methanamine (PubChem CID 82059890) has the molecular formula C13H12N4 and a molecular weight of 224.27 g/mol. Its IUPAC name is (2-pyridin-2-ylimidazo[1,2-a]pyridin-6-yl)methanamine.
| Compound Name | (2-pyridin-2-ylimidazo[1,2-a]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 82059890 |
| Molecular Formula | C13H12N4 |
| Molecular Weight | 224.27 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | (2-pyridin-2-ylimidazo[1,2-a]pyridin-6-yl)methanamine |
| SMILES | NCc1ccc2nc(-c3ccccn3)cn2c1 |
| InChI | InChI=1S/C13H12N4/c14-7-10-4-5-13-16-12(9-17(13)8-10)11-3-1-2-6-15-11/h1-6,8-9H,7,14H2 |
| InChIKey | FMVHUDSSBNXHPW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |