About (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol
(3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol (PubChem CID 82062061) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol.
Molecular Properties
| Compound Name | (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol |
| PubChem CID | 82062061 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol |
| SMILES | CC(C)(C)c1csc2ncc(CO)n12 |
| InChI | InChI=1S/C10H14N2OS/c1-10(2,3)8-6-14-9-11-4-7(5-13)12(8)9/h4,6,13H,5H2,1-3H3 |
| InChIKey | PMCJVPYHNWILLL-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
The IUPAC name of (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol (CID 82062061) is (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol.
What is the SMILES notation for (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
The canonical SMILES for (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is CC(C)(C)c1csc2ncc(CO)n12.
What is the InChIKey of (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
The InChIKey is PMCJVPYHNWILLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-10(2,3)8-6-14-9-11-4-7(5-13)12(8)9/h4,6,13H,5H2,1-3H3.
What are the key properties of (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol?
(3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol has a molecular weight of 210.30 g/mol, XLogP of 2.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-tert-butylimidazo[2,1-b][1,3]thiazol-5-yl)methanol is sourced from PubChem (CID 82062061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).