About 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde
3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde (PubChem CID 82062150) has the molecular formula C11H7N3OS
and a molecular weight of 229.26 g/mol. Its IUPAC name is 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde.
Molecular Properties
| Compound Name | 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde |
| PubChem CID | 82062150 |
| Molecular Formula | C11H7N3OS |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde |
| SMILES | O=Cc1cn2c(-c3ccccn3)csc2n1 |
| InChI | InChI=1S/C11H7N3OS/c15-6-8-5-14-10(7-16-11(14)13-8)9-3-1-2-4-12-9/h1-7H |
| InChIKey | FULBJQCOXMSQIF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde?
The IUPAC name of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde (CID 82062150) is 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde.
What is the SMILES notation for 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde?
The canonical SMILES for 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde is O=Cc1cn2c(-c3ccccn3)csc2n1.
What is the InChIKey of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde?
The InChIKey is FULBJQCOXMSQIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3OS/c15-6-8-5-14-10(7-16-11(14)13-8)9-3-1-2-4-12-9/h1-7H.
What are the key properties of 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde?
3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde has a molecular weight of 229.26 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyridin-2-ylimidazo[2,1-b][1,3]thiazole-6-carbaldehyde is sourced from PubChem (CID 82062150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).