C12H13N3O3 — CID 82062834
5-(piperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one (PubChem CID 82062834) has the molecular formula C12H13N3O3 and a molecular weight of 247.25 g/mol. Its IUPAC name is 5-(piperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 5-(piperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 82062834 |
| Molecular Formula | C12H13N3O3 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 5-(piperazine-1-carbonyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=C(c1ccc2oc(=O)[nH]c2c1)N1CCNCC1 |
| InChI | InChI=1S/C12H13N3O3/c16-11(15-5-3-13-4-6-15)8-1-2-10-9(7-8)14-12(17)18-10/h1-2,7,13H,3-6H2,(H,14,17) |
| InChIKey | UYMRZEMFBOTJMH-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |