C12H18N2O — CID 82063139
N,4-diethyl-2,3-dihydro-1,4-benzoxazin-7-amine (PubChem CID 82063139) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N,4-diethyl-2,3-dihydro-1,4-benzoxazin-7-amine.
| Compound Name | N,4-diethyl-2,3-dihydro-1,4-benzoxazin-7-amine |
|---|---|
| PubChem CID | 82063139 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N,4-diethyl-2,3-dihydro-1,4-benzoxazin-7-amine |
| SMILES | CCNc1ccc2c(c1)OCCN2CC |
| InChI | InChI=1S/C12H18N2O/c1-3-13-10-5-6-11-12(9-10)15-8-7-14(11)4-2/h5-6,9,13H,3-4,7-8H2,1-2H3 |
| InChIKey | ANSWORZJMNWJEA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|