About 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid
4-imidazo[1,2-a]pyridin-6-ylbenzoic acid (PubChem CID 82063340) has the molecular formula C14H10N2O2
and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid |
| PubChem CID | 82063340 |
| Molecular Formula | C14H10N2O2 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid |
| SMILES | O=C(O)c1ccc(-c2ccc3nccn3c2)cc1 |
| InChI | InChI=1S/C14H10N2O2/c17-14(18)11-3-1-10(2-4-11)12-5-6-13-15-7-8-16(13)9-12/h1-9H,(H,17,18) |
| InChIKey | VJNXBHZYFWHPLE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 54.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
The IUPAC name of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid (CID 82063340) is 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid.
What is the SMILES notation for 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
The canonical SMILES for 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid is O=C(O)c1ccc(-c2ccc3nccn3c2)cc1.
What is the InChIKey of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
The InChIKey is VJNXBHZYFWHPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-14(18)11-3-1-10(2-4-11)12-5-6-13-15-7-8-16(13)9-12/h1-9H,(H,17,18).
What are the key properties of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
4-imidazo[1,2-a]pyridin-6-ylbenzoic acid has a molecular weight of 238.25 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid is sourced from PubChem (CID 82063340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).