4-imidazo[1,2-a]pyridin-6-ylbenzoic acid

C14H10N2O2 — CID 82063340

IUPAC4-imidazo[1,2-a]pyridin-6-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2ccc3nccn3c2)cc1
InChIInChI=1S/C14H10N2O2/c17-14(18)11-3-1-10(2-4-11)12-5-6-13-15-7-8-16(13)9-12/h1-9H,(H,17,18)
InChIKeyVJNXBHZYFWHPLE-UHFFFAOYSA-N
MW238.25 g/mol
LogP2.70
Rot. Bonds2

About 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid

4-imidazo[1,2-a]pyridin-6-ylbenzoic acid (PubChem CID 82063340) has the molecular formula C14H10N2O2 and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid.

Molecular Properties

Compound Name4-imidazo[1,2-a]pyridin-6-ylbenzoic acid
PubChem CID82063340
Molecular FormulaC14H10N2O2
Molecular Weight238.25 g/mol
Exact Mass238.07
IUPAC Name4-imidazo[1,2-a]pyridin-6-ylbenzoic acid
SMILESO=C(O)c1ccc(-c2ccc3nccn3c2)cc1
InChIInChI=1S/C14H10N2O2/c17-14(18)11-3-1-10(2-4-11)12-5-6-13-15-7-8-16(13)9-12/h1-9H,(H,17,18)
InChIKeyVJNXBHZYFWHPLE-UHFFFAOYSA-N
XLogP2.70
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500238.25
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
The IUPAC name of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid (CID 82063340) is 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid.
What is the SMILES notation for 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
The canonical SMILES for 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid is O=C(O)c1ccc(-c2ccc3nccn3c2)cc1.
What is the InChIKey of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
The InChIKey is VJNXBHZYFWHPLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10N2O2/c17-14(18)11-3-1-10(2-4-11)12-5-6-13-15-7-8-16(13)9-12/h1-9H,(H,17,18).
What are the key properties of 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid?
4-imidazo[1,2-a]pyridin-6-ylbenzoic acid has a molecular weight of 238.25 g/mol, XLogP of 2.70, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyridin-6-ylbenzoic acid is sourced from PubChem (CID 82063340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).