C15H21NO5 — CID 82063964
N-cyclohexyl-2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-methylacetamide (PubChem CID 82063964) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is N-cyclohexyl-2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-methylacetamide.
| Compound Name | N-cyclohexyl-2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-methylacetamide |
|---|---|
| PubChem CID | 82063964 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-cyclohexyl-2-[6-(hydroxymethyl)-4-oxopyran-3-yl]oxy-N-methylacetamide |
| SMILES | CN(C(=O)COc1coc(CO)cc1=O)C1CCCCC1 |
| InChI | InChI=1S/C15H21NO5/c1-16(11-5-3-2-4-6-11)15(19)10-21-14-9-20-12(8-17)7-13(14)18/h7,9,11,17H,2-6,8,10H2,1H3 |
| InChIKey | UPIBVCGNHJHENA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |