C17H18N2O2 — CID 82064349
[2-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-7-yl]methanol (PubChem CID 82064349) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is [2-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-7-yl]methanol.
| Compound Name | [2-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-7-yl]methanol |
|---|---|
| PubChem CID | 82064349 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | [2-(4-propan-2-yloxyphenyl)imidazo[1,2-a]pyridin-7-yl]methanol |
| SMILES | CC(C)Oc1ccc(-c2cn3ccc(CO)cc3n2)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-12(2)21-15-5-3-14(4-6-15)16-10-19-8-7-13(11-20)9-17(19)18-16/h3-10,12,20H,11H2,1-2H3 |
| InChIKey | ZAXFGIZAUHLRJM-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |