About 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid
2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (PubChem CID 82064502) has the molecular formula C12H7F4NO2S
and a molecular weight of 305.25 g/mol. Its IUPAC name is 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 82064502 |
| Molecular Formula | C12H7F4NO2S |
| Molecular Weight | 305.25 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid |
| SMILES | O=C(O)c1sc(Cc2ccccc2F)nc1C(F)(F)F |
| InChI | InChI=1S/C12H7F4NO2S/c13-7-4-2-1-3-6(7)5-8-17-10(12(14,15)16)9(20-8)11(18)19/h1-4H,5H2,(H,18,19) |
| InChIKey | AODWBJBQEWOELO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.25 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid (CID 82064502) is 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is O=C(O)c1sc(Cc2ccccc2F)nc1C(F)(F)F.
What is the InChIKey of 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
The InChIKey is AODWBJBQEWOELO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7F4NO2S/c13-7-4-2-1-3-6(7)5-8-17-10(12(14,15)16)9(20-8)11(18)19/h1-4H,5H2,(H,18,19).
What are the key properties of 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid?
2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid has a molecular weight of 305.25 g/mol, XLogP of 3.59, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-fluorophenyl)methyl]-4-(trifluoromethyl)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 82064502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).