C15H11Cl3N2OS — CID 82065001
2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 82065001) has the molecular formula C15H11Cl3N2OS and a molecular weight of 373.69 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 82065001 |
| Molecular Formula | C15H11Cl3N2OS |
| Molecular Weight | 373.69 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2-(1-chloroethyl)-5-(3,4-dichlorophenyl)-6-methyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | Cc1sc2nc(C(C)Cl)[nH]c(=O)c2c1-c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl3N2OS/c1-6(16)13-19-14(21)12-11(7(2)22-15(12)20-13)8-3-4-9(17)10(18)5-8/h3-6H,1-2H3,(H,19,20,21) |
| InChIKey | OUPJWSQTZYGXNJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.69 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|