C15H14N4O2 — CID 82068172
3-(4-amino-2-pyridin-4-ylbenzimidazol-1-yl)propanoic acid (PubChem CID 82068172) has the molecular formula C15H14N4O2 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-(4-amino-2-pyridin-4-ylbenzimidazol-1-yl)propanoic acid.
| Compound Name | 3-(4-amino-2-pyridin-4-ylbenzimidazol-1-yl)propanoic acid |
|---|---|
| PubChem CID | 82068172 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 3-(4-amino-2-pyridin-4-ylbenzimidazol-1-yl)propanoic acid |
| SMILES | Nc1cccc2c1nc(-c1ccncc1)n2CCC(=O)O |
| InChI | InChI=1S/C15H14N4O2/c16-11-2-1-3-12-14(11)18-15(10-4-7-17-8-5-10)19(12)9-6-13(20)21/h1-5,7-8H,6,9,16H2,(H,20,21) |
| InChIKey | RAOQIDAWXAWKSX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|