C14H15N3OS — CID 82068426
3-(4-propan-2-yloxyphenyl)imidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 82068426) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-(4-propan-2-yloxyphenyl)imidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 3-(4-propan-2-yloxyphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 82068426 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-(4-propan-2-yloxyphenyl)imidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | CC(C)Oc1ccc(-c2csc3ncc(N)n23)cc1 |
| InChI | InChI=1S/C14H15N3OS/c1-9(2)18-11-5-3-10(4-6-11)12-8-19-14-16-7-13(15)17(12)14/h3-9H,15H2,1-2H3 |
| InChIKey | GLGTUEDLVIWLIY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |