C13H21N3S — CID 82068628
3,6-ditert-butylimidazo[2,1-b][1,3]thiazol-5-amine (PubChem CID 82068628) has the molecular formula C13H21N3S and a molecular weight of 251.40 g/mol. Its IUPAC name is 3,6-ditert-butylimidazo[2,1-b][1,3]thiazol-5-amine.
| Compound Name | 3,6-ditert-butylimidazo[2,1-b][1,3]thiazol-5-amine |
|---|---|
| PubChem CID | 82068628 |
| Molecular Formula | C13H21N3S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 3,6-ditert-butylimidazo[2,1-b][1,3]thiazol-5-amine |
| SMILES | CC(C)(C)c1nc2scc(C(C)(C)C)n2c1N |
| InChI | InChI=1S/C13H21N3S/c1-12(2,3)8-7-17-11-15-9(13(4,5)6)10(14)16(8)11/h7H,14H2,1-6H3 |
| InChIKey | KCVKJHLLYRQPFQ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |