2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid

C16H19NO2S — CID 82069390

IUPAC2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid
SMILESCCCc1nc(-c2ccc(C)cc2C)c(CC(=O)O)s1
InChIInChI=1S/C16H19NO2S/c1-4-5-14-17-16(13(20-14)9-15(18)19)12-7-6-10(2)8-11(12)3/h6-8H,4-5,9H2,1-3H3,(H,18,19)
InChIKeyMZWDVOYLCDYEDG-UHFFFAOYSA-N
MW289.40 g/mol
LogP4.01
Rot. Bonds5

About 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid

2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid (PubChem CID 82069390) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid
PubChem CID82069390
Molecular FormulaC16H19NO2S
Molecular Weight289.40 g/mol
Exact Mass289.11
IUPAC Name2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid
SMILESCCCc1nc(-c2ccc(C)cc2C)c(CC(=O)O)s1
InChIInChI=1S/C16H19NO2S/c1-4-5-14-17-16(13(20-14)9-15(18)19)12-7-6-10(2)8-11(12)3/h6-8H,4-5,9H2,1-3H3,(H,18,19)
InChIKeyMZWDVOYLCDYEDG-UHFFFAOYSA-N
XLogP4.01
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.40
LogP ≤ 54.01
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid?
The IUPAC name of 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid (CID 82069390) is 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid.
What is the SMILES notation for 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid?
The canonical SMILES for 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid is CCCc1nc(-c2ccc(C)cc2C)c(CC(=O)O)s1.
What is the InChIKey of 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid?
The InChIKey is MZWDVOYLCDYEDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c1-4-5-14-17-16(13(20-14)9-15(18)19)12-7-6-10(2)8-11(12)3/h6-8H,4-5,9H2,1-3H3,(H,18,19).
What are the key properties of 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid?
2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid has a molecular weight of 289.40 g/mol, XLogP of 4.01, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,4-dimethylphenyl)-2-propyl-1,3-thiazol-5-yl]acetic acid is sourced from PubChem (CID 82069390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).