About 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde
4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde (PubChem CID 82070696) has the molecular formula C11H15ClN2O5
and a molecular weight of 290.70 g/mol. Its IUPAC name is 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde.
Molecular Properties
| Compound Name | 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde |
| PubChem CID | 82070696 |
| Molecular Formula | C11H15ClN2O5 |
| Molecular Weight | 290.70 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde |
| SMILES | COCCn1c(Cl)c(C=O)c(=O)n(CCOC)c1=O |
| InChI | InChI=1S/C11H15ClN2O5/c1-18-5-3-13-9(12)8(7-15)10(16)14(11(13)17)4-6-19-2/h7H,3-6H2,1-2H3 |
| InChIKey | DZXHSQMSLACCQH-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 79.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.70 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde?
The IUPAC name of 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde (CID 82070696) is 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde.
What is the SMILES notation for 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde?
The canonical SMILES for 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde is COCCn1c(Cl)c(C=O)c(=O)n(CCOC)c1=O.
What is the InChIKey of 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde?
The InChIKey is DZXHSQMSLACCQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClN2O5/c1-18-5-3-13-9(12)8(7-15)10(16)14(11(13)17)4-6-19-2/h7H,3-6H2,1-2H3.
What are the key properties of 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde?
4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde has a molecular weight of 290.70 g/mol, XLogP of -0.23, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-1,3-bis(2-methoxyethyl)-2,6-dioxopyrimidine-5-carbaldehyde is sourced from PubChem (CID 82070696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).