About [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine
[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine (PubChem CID 82071988) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine.
Molecular Properties
| Compound Name | [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine |
| PubChem CID | 82071988 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine |
| SMILES | NCC1=NNC(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C10H12ClN3/c11-8-3-1-7(2-4-8)10-5-9(6-12)13-14-10/h1-4,10,14H,5-6,12H2 |
| InChIKey | NOCOKPLKIABNPY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine?
The IUPAC name of [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine (CID 82071988) is [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine.
What is the SMILES notation for [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine?
The canonical SMILES for [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine is NCC1=NNC(c2ccc(Cl)cc2)C1.
What is the InChIKey of [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine?
The InChIKey is NOCOKPLKIABNPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c11-8-3-1-7(2-4-8)10-5-9(6-12)13-14-10/h1-4,10,14H,5-6,12H2.
What are the key properties of [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine?
[5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine has a molecular weight of 209.68 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(4-chlorophenyl)-4,5-dihydro-1H-pyrazol-3-yl]methanamine is sourced from PubChem (CID 82071988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).