C19H23N3O2 — CID 82072414
2-[2,3-bis(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]ethanamine (PubChem CID 82072414) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 2-[2,3-bis(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]ethanamine.
| Compound Name | 2-[2,3-bis(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 82072414 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 2-[2,3-bis(3-methoxyphenyl)-3,4-dihydropyrazol-5-yl]ethanamine |
| SMILES | COc1cccc(C2CC(CCN)=NN2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C19H23N3O2/c1-23-17-7-3-5-14(11-17)19-12-15(9-10-20)21-22(19)16-6-4-8-18(13-16)24-2/h3-8,11,13,19H,9-10,12,20H2,1-2H3 |
| InChIKey | HEOWPVWNAXMLEM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 60.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |