C19H31NO2 — CID 82073844
3-[cyclohexyl(methyl)amino]-1-(4-propan-2-yloxyphenyl)propan-1-ol (PubChem CID 82073844) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3-[cyclohexyl(methyl)amino]-1-(4-propan-2-yloxyphenyl)propan-1-ol.
| Compound Name | 3-[cyclohexyl(methyl)amino]-1-(4-propan-2-yloxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 82073844 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 3-[cyclohexyl(methyl)amino]-1-(4-propan-2-yloxyphenyl)propan-1-ol |
| SMILES | CC(C)Oc1ccc(C(O)CCN(C)C2CCCCC2)cc1 |
| InChI | InChI=1S/C19H31NO2/c1-15(2)22-18-11-9-16(10-12-18)19(21)13-14-20(3)17-7-5-4-6-8-17/h9-12,15,17,19,21H,4-8,13-14H2,1-3H3 |
| InChIKey | RYIIDXJQAVJZRC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |