C17H27N3O — CID 82074067
1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-ol (PubChem CID 82074067) has the molecular formula C17H27N3O and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-ol.
| Compound Name | 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 82074067 |
| Molecular Formula | C17H27N3O |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.22 |
| IUPAC Name | 1-(1-methyl-3,4-dihydro-2H-quinolin-6-yl)-3-piperazin-1-ylpropan-1-ol |
| SMILES | CN1CCCc2cc(C(O)CCN3CCNCC3)ccc21 |
| InChI | InChI=1S/C17H27N3O/c1-19-9-2-3-14-13-15(4-5-16(14)19)17(21)6-10-20-11-7-18-8-12-20/h4-5,13,17-18,21H,2-3,6-12H2,1H3 |
| InChIKey | UXVGOQDTPZAQMM-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|