About 2-(4-methoxy-2,5-dimethylphenyl)oxirane
2-(4-methoxy-2,5-dimethylphenyl)oxirane (PubChem CID 82074963) has the molecular formula C11H14O2
and a molecular weight of 178.23 g/mol. Its IUPAC name is 2-(4-methoxy-2,5-dimethylphenyl)oxirane.
Molecular Properties
| Compound Name | 2-(4-methoxy-2,5-dimethylphenyl)oxirane |
| PubChem CID | 82074963 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 2-(4-methoxy-2,5-dimethylphenyl)oxirane |
| SMILES | COc1cc(C)c(C2CO2)cc1C |
| InChI | InChI=1S/C11H14O2/c1-7-5-10(12-3)8(2)4-9(7)11-6-13-11/h4-5,11H,6H2,1-3H3 |
| InChIKey | ADODWRHTBSPHEG-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-methoxy-2,5-dimethylphenyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-methoxy-2,5-dimethylphenyl)oxirane?
The IUPAC name of 2-(4-methoxy-2,5-dimethylphenyl)oxirane (CID 82074963) is 2-(4-methoxy-2,5-dimethylphenyl)oxirane.
What is the SMILES notation for 2-(4-methoxy-2,5-dimethylphenyl)oxirane?
The canonical SMILES for 2-(4-methoxy-2,5-dimethylphenyl)oxirane is COc1cc(C)c(C2CO2)cc1C.
What is the InChIKey of 2-(4-methoxy-2,5-dimethylphenyl)oxirane?
The InChIKey is ADODWRHTBSPHEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O2/c1-7-5-10(12-3)8(2)4-9(7)11-6-13-11/h4-5,11H,6H2,1-3H3.
What are the key properties of 2-(4-methoxy-2,5-dimethylphenyl)oxirane?
2-(4-methoxy-2,5-dimethylphenyl)oxirane has a molecular weight of 178.23 g/mol, XLogP of 2.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-methoxy-2,5-dimethylphenyl)oxirane is sourced from PubChem (CID 82074963), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).