C9H13N3O2 — CID 82076034
6-amino-5-(2,2-dimethylpropanoyl)-1H-pyrimidin-2-one (PubChem CID 82076034) has the molecular formula C9H13N3O2 and a molecular weight of 195.22 g/mol. Its IUPAC name is 6-amino-5-(2,2-dimethylpropanoyl)-1H-pyrimidin-2-one.
| Compound Name | 6-amino-5-(2,2-dimethylpropanoyl)-1H-pyrimidin-2-one |
|---|---|
| PubChem CID | 82076034 |
| Molecular Formula | C9H13N3O2 |
| Molecular Weight | 195.22 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | 6-amino-5-(2,2-dimethylpropanoyl)-1H-pyrimidin-2-one |
| SMILES | CC(C)(C)C(=O)c1cnc(=O)[nH]c1N |
| InChI | InChI=1S/C9H13N3O2/c1-9(2,3)6(13)5-4-11-8(14)12-7(5)10/h4H,1-3H3,(H3,10,11,12,14) |
| InChIKey | DFSYHBCELZMXBB-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |