C11H9ClO2 — CID 82077740
(2E)-2-(6-chloro-2,3-dihydroinden-1-ylidene)acetic acid (PubChem CID 82077740) has the molecular formula C11H9ClO2 and a molecular weight of 208.64 g/mol. Its IUPAC name is (2E)-2-(6-chloro-2,3-dihydroinden-1-ylidene)acetic acid.
| Compound Name | (2E)-2-(6-chloro-2,3-dihydroinden-1-ylidene)acetic acid |
|---|---|
| PubChem CID | 82077740 |
| Molecular Formula | C11H9ClO2 |
| Molecular Weight | 208.64 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | (2E)-2-(6-chloro-2,3-dihydroinden-1-ylidene)acetic acid |
| SMILES | O=C(O)/C=C1\CCc2ccc(Cl)cc21 |
| InChI | InChI=1S/C11H9ClO2/c12-9-4-3-7-1-2-8(5-11(13)14)10(7)6-9/h3-6H,1-2H2,(H,13,14)/b8-5+ |
| InChIKey | BZBPRCLWSWLSCH-VMPITWQZSA-N |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.64 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|