C7H5FN2O3S — CID 82078731
5-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 82078731) has the molecular formula C7H5FN2O3S and a molecular weight of 216.19 g/mol. Its IUPAC name is 5-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 5-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 82078731 |
| Molecular Formula | C7H5FN2O3S |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.00 |
| IUPAC Name | 5-fluoro-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | O=C1Nc2c(F)cccc2S(=O)(=O)N1 |
| InChI | InChI=1S/C7H5FN2O3S/c8-4-2-1-3-5-6(4)9-7(11)10-14(5,12)13/h1-3H,(H2,9,10,11) |
| InChIKey | ORDOVOAXLGQUIE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |