About [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol
[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol (PubChem CID 820796) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol.
Molecular Properties
| Compound Name | [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| PubChem CID | 820796 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol |
| SMILES | OC[C@@H]1CC(c2ccccc2)=NO1 |
| InChI | InChI=1S/C10H11NO2/c12-7-9-6-10(11-13-9)8-4-2-1-3-5-8/h1-5,9,12H,6-7H2/t9-/m0/s1 |
| InChIKey | GXUGWAXJXGJRAH-VIFPVBQESA-N |
| XLogP | 1.17 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The IUPAC name of [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol (CID 820796) is [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol.
What is the SMILES notation for [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The canonical SMILES for [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol is OC[C@@H]1CC(c2ccccc2)=NO1.
What is the InChIKey of [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol?
The InChIKey is GXUGWAXJXGJRAH-VIFPVBQESA-N. The full InChI is InChI=1S/C10H11NO2/c12-7-9-6-10(11-13-9)8-4-2-1-3-5-8/h1-5,9,12H,6-7H2/t9-/m0/s1.
What are the key properties of [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol?
[(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol has a molecular weight of 177.20 g/mol, XLogP of 1.17, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S)-3-phenyl-4,5-dihydro-1,2-oxazol-5-yl]methanol is sourced from PubChem (CID 820796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).