About 2-(2,4,6-trimethylphenyl)thiomorpholine
2-(2,4,6-trimethylphenyl)thiomorpholine (PubChem CID 82080150) has the molecular formula C13H19NS
and a molecular weight of 221.37 g/mol. Its IUPAC name is 2-(2,4,6-trimethylphenyl)thiomorpholine.
Molecular Properties
| Compound Name | 2-(2,4,6-trimethylphenyl)thiomorpholine |
| PubChem CID | 82080150 |
| Molecular Formula | C13H19NS |
| Molecular Weight | 221.37 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 2-(2,4,6-trimethylphenyl)thiomorpholine |
| SMILES | Cc1cc(C)c(C2CNCCS2)c(C)c1 |
| InChI | InChI=1S/C13H19NS/c1-9-6-10(2)13(11(3)7-9)12-8-14-4-5-15-12/h6-7,12,14H,4-5,8H2,1-3H3 |
| InChIKey | QAXIGVSRIHBMJX-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.37 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,4,6-trimethylphenyl)thiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4,6-trimethylphenyl)thiomorpholine?
The IUPAC name of 2-(2,4,6-trimethylphenyl)thiomorpholine (CID 82080150) is 2-(2,4,6-trimethylphenyl)thiomorpholine.
What is the SMILES notation for 2-(2,4,6-trimethylphenyl)thiomorpholine?
The canonical SMILES for 2-(2,4,6-trimethylphenyl)thiomorpholine is Cc1cc(C)c(C2CNCCS2)c(C)c1.
What is the InChIKey of 2-(2,4,6-trimethylphenyl)thiomorpholine?
The InChIKey is QAXIGVSRIHBMJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NS/c1-9-6-10(2)13(11(3)7-9)12-8-14-4-5-15-12/h6-7,12,14H,4-5,8H2,1-3H3.
What are the key properties of 2-(2,4,6-trimethylphenyl)thiomorpholine?
2-(2,4,6-trimethylphenyl)thiomorpholine has a molecular weight of 221.37 g/mol, XLogP of 2.99, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4,6-trimethylphenyl)thiomorpholine is sourced from PubChem (CID 82080150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).