C9H10N2O3S — CID 82080973
5,7-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one (PubChem CID 82080973) has the molecular formula C9H10N2O3S and a molecular weight of 226.26 g/mol. Its IUPAC name is 5,7-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one.
| Compound Name | 5,7-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
|---|---|
| PubChem CID | 82080973 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 5,7-dimethyl-1,1-dioxo-4H-1λ6,2,4-benzothiadiazin-3-one |
| SMILES | Cc1cc(C)c2c(c1)S(=O)(=O)NC(=O)N2 |
| InChI | InChI=1S/C9H10N2O3S/c1-5-3-6(2)8-7(4-5)15(13,14)11-9(12)10-8/h3-4H,1-2H3,(H2,10,11,12) |
| InChIKey | OLDBDPLNTRFOOO-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |