C12H18ClNO — CID 82081284
2-(3-chloro-4-methoxyphenyl)-N,2-dimethylpropan-1-amine (PubChem CID 82081284) has the molecular formula C12H18ClNO and a molecular weight of 227.73 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyphenyl)-N,2-dimethylpropan-1-amine.
| Compound Name | 2-(3-chloro-4-methoxyphenyl)-N,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 82081284 |
| Molecular Formula | C12H18ClNO |
| Molecular Weight | 227.73 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 2-(3-chloro-4-methoxyphenyl)-N,2-dimethylpropan-1-amine |
| SMILES | CNCC(C)(C)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C12H18ClNO/c1-12(2,8-14-3)9-5-6-11(15-4)10(13)7-9/h5-7,14H,8H2,1-4H3 |
| InChIKey | CUXORSQRCRECOZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.73 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |