C14H15NS — CID 82081689
2-(2-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole (PubChem CID 82081689) has the molecular formula C14H15NS and a molecular weight of 229.35 g/mol. Its IUPAC name is 2-(2-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole.
| Compound Name | 2-(2-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole |
|---|---|
| PubChem CID | 82081689 |
| Molecular Formula | C14H15NS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-(2-methylphenyl)-4,5,6,7-tetrahydro-1,3-benzothiazole |
| SMILES | Cc1ccccc1-c1nc2c(s1)CCCC2 |
| InChI | InChI=1S/C14H15NS/c1-10-6-2-3-7-11(10)14-15-12-8-4-5-9-13(12)16-14/h2-3,6-7H,4-5,8-9H2,1H3 |
| InChIKey | CQQALYATGJJEHR-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |