C12H11NO4 — CID 82082678
3-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,5-dione (PubChem CID 82082678) has the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. Its IUPAC name is 3-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,5-dione.
| Compound Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 82082678 |
| Molecular Formula | C12H11NO4 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 3-(2,3-dihydro-1,4-benzodioxin-6-yl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(c2ccc3c(c2)OCCO3)C(=O)N1 |
| InChI | InChI=1S/C12H11NO4/c14-11-6-8(12(15)13-11)7-1-2-9-10(5-7)17-4-3-16-9/h1-2,5,8H,3-4,6H2,(H,13,14,15) |
| InChIKey | DNROWPVGFDUNTE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|