About 1-(2-fluorophenyl)-4,4-dimethoxypiperidine
1-(2-fluorophenyl)-4,4-dimethoxypiperidine (PubChem CID 820828) has the molecular formula C13H18FNO2
and a molecular weight of 239.29 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-4,4-dimethoxypiperidine.
Molecular Properties
| Compound Name | 1-(2-fluorophenyl)-4,4-dimethoxypiperidine |
| PubChem CID | 820828 |
| Molecular Formula | C13H18FNO2 |
| Molecular Weight | 239.29 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 1-(2-fluorophenyl)-4,4-dimethoxypiperidine |
| SMILES | COC1(OC)CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C13H18FNO2/c1-16-13(17-2)7-9-15(10-8-13)12-6-4-3-5-11(12)14/h3-6H,7-10H2,1-2H3 |
| InChIKey | KIKZIAQEPDLOCW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.29 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-fluorophenyl)-4,4-dimethoxypiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluorophenyl)-4,4-dimethoxypiperidine?
The IUPAC name of 1-(2-fluorophenyl)-4,4-dimethoxypiperidine (CID 820828) is 1-(2-fluorophenyl)-4,4-dimethoxypiperidine.
What is the SMILES notation for 1-(2-fluorophenyl)-4,4-dimethoxypiperidine?
The canonical SMILES for 1-(2-fluorophenyl)-4,4-dimethoxypiperidine is COC1(OC)CCN(c2ccccc2F)CC1.
What is the InChIKey of 1-(2-fluorophenyl)-4,4-dimethoxypiperidine?
The InChIKey is KIKZIAQEPDLOCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18FNO2/c1-16-13(17-2)7-9-15(10-8-13)12-6-4-3-5-11(12)14/h3-6H,7-10H2,1-2H3.
What are the key properties of 1-(2-fluorophenyl)-4,4-dimethoxypiperidine?
1-(2-fluorophenyl)-4,4-dimethoxypiperidine has a molecular weight of 239.29 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluorophenyl)-4,4-dimethoxypiperidine is sourced from PubChem (CID 820828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).