C10H11ClN4O — CID 82084148
5-[2-(2-chloro-5-methylphenoxy)ethyl]-2H-tetrazole (PubChem CID 82084148) has the molecular formula C10H11ClN4O and a molecular weight of 238.68 g/mol. Its IUPAC name is 5-[2-(2-chloro-5-methylphenoxy)ethyl]-2H-tetrazole.
| Compound Name | 5-[2-(2-chloro-5-methylphenoxy)ethyl]-2H-tetrazole |
|---|---|
| PubChem CID | 82084148 |
| Molecular Formula | C10H11ClN4O |
| Molecular Weight | 238.68 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 5-[2-(2-chloro-5-methylphenoxy)ethyl]-2H-tetrazole |
| SMILES | Cc1ccc(Cl)c(OCCc2nn[nH]n2)c1 |
| InChI | InChI=1S/C10H11ClN4O/c1-7-2-3-8(11)9(6-7)16-5-4-10-12-14-15-13-10/h2-3,6H,4-5H2,1H3,(H,12,13,14,15) |
| InChIKey | MDYHOVBVCVFJTH-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.68 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |