C11H13NO3S — CID 82084310
2-(2,6-dimethylphenyl)-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 82084310) has the molecular formula C11H13NO3S and a molecular weight of 239.30 g/mol. Its IUPAC name is 2-(2,6-dimethylphenyl)-1,1-dioxo-1,2-thiazolidin-3-one.
| Compound Name | 2-(2,6-dimethylphenyl)-1,1-dioxo-1,2-thiazolidin-3-one |
|---|---|
| PubChem CID | 82084310 |
| Molecular Formula | C11H13NO3S |
| Molecular Weight | 239.30 g/mol |
| Exact Mass | 239.06 |
| IUPAC Name | 2-(2,6-dimethylphenyl)-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | Cc1cccc(C)c1N1C(=O)CCS1(=O)=O |
| InChI | InChI=1S/C11H13NO3S/c1-8-4-3-5-9(2)11(8)12-10(13)6-7-16(12,14)15/h3-5H,6-7H2,1-2H3 |
| InChIKey | JQPXQIFQSPZYJQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.30 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |