About 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one
2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one (PubChem CID 82085075) has the molecular formula C10H10FNO3S
and a molecular weight of 243.26 g/mol. Its IUPAC name is 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one.
Molecular Properties
| Compound Name | 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one |
| PubChem CID | 82085075 |
| Molecular Formula | C10H10FNO3S |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one |
| SMILES | CC1CS(=O)(=O)N(c2ccccc2F)C1=O |
| InChI | InChI=1S/C10H10FNO3S/c1-7-6-16(14,15)12(10(7)13)9-5-3-2-4-8(9)11/h2-5,7H,6H2,1H3 |
| InChIKey | AYZRVLKMNGXDPY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one?
The IUPAC name of 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one (CID 82085075) is 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one.
What is the SMILES notation for 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one?
The canonical SMILES for 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one is CC1CS(=O)(=O)N(c2ccccc2F)C1=O.
What is the InChIKey of 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one?
The InChIKey is AYZRVLKMNGXDPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FNO3S/c1-7-6-16(14,15)12(10(7)13)9-5-3-2-4-8(9)11/h2-5,7H,6H2,1H3.
What are the key properties of 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one?
2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one has a molecular weight of 243.26 g/mol, XLogP of 1.14, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-fluorophenyl)-4-methyl-1,1-dioxo-1,2-thiazolidin-3-one is sourced from PubChem (CID 82085075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).